C18H24N2O3S2 — CID 39741661
N-[(3aS,6aS)-3-(3,4-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide (PubChem CID 39741661) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is N-[(3aS,6aS)-3-(3,4-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide.
| Compound Name | N-[(3aS,6aS)-3-(3,4-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 39741661 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(3aS,6aS)-3-(3,4-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc(N2/C(=N/C(=O)C(C)(C)C)S[C@@H]3CS(=O)(=O)C[C@@H]32)cc1C |
| InChI | InChI=1S/C18H24N2O3S2/c1-11-6-7-13(8-12(11)2)20-14-9-25(22,23)10-15(14)24-17(20)19-16(21)18(3,4)5/h6-8,14-15H,9-10H2,1-5H3/b19-17-/t14-,15+/m0/s1 |
| InChIKey | ZDJNAALVVZJKCG-LTDXQCTPSA-N |
| XLogP | 2.95 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|