C14H11N3O2S — CID 3974566
2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl)isoindole-1,3-dione (PubChem CID 3974566) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl)isoindole-1,3-dione.
| Compound Name | 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 3974566 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1=CSC2=NCCN12 |
| InChI | InChI=1S/C14H11N3O2S/c18-12-10-3-1-2-4-11(10)13(19)17(12)7-9-8-20-14-15-5-6-16(9)14/h1-4,8H,5-7H2 |
| InChIKey | WHRMAGBGLHVIJV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|