About 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide
2-(3-hydroxyphenyl)-N,N-dimethylbenzamide (PubChem CID 39746103) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide |
| PubChem CID | 39746103 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1-c1cccc(O)c1 |
| InChI | InChI=1S/C15H15NO2/c1-16(2)15(18)14-9-4-3-8-13(14)11-6-5-7-12(17)10-11/h3-10,17H,1-2H3 |
| InChIKey | GTTWMFVYJSQWCN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide?
The IUPAC name of 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide (CID 39746103) is 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide.
What is the SMILES notation for 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide?
The canonical SMILES for 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide is CN(C)C(=O)c1ccccc1-c1cccc(O)c1.
What is the InChIKey of 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide?
The InChIKey is GTTWMFVYJSQWCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-16(2)15(18)14-9-4-3-8-13(14)11-6-5-7-12(17)10-11/h3-10,17H,1-2H3.
What are the key properties of 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide?
2-(3-hydroxyphenyl)-N,N-dimethylbenzamide has a molecular weight of 241.29 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxyphenyl)-N,N-dimethylbenzamide is sourced from PubChem (CID 39746103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).