C17H31NO — CID 39746149
1-[2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]ethyl]cyclopentan-1-ol (PubChem CID 39746149) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-[2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]ethyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]ethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 39746149 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 1-[2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]ethyl]cyclopentan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CNCCC1(O)CCCC1 |
| InChI | InChI=1S/C17H31NO/c1-15(2)7-6-8-16(3)9-13-18-14-12-17(19)10-4-5-11-17/h7,9,18-19H,4-6,8,10-14H2,1-3H3/b16-9+ |
| InChIKey | ALJOELGRVXTGSR-CXUHLZMHSA-N |
| XLogP | 3.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|