C20H29N3O5 — CID 39752666
4-ethoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]-3-nitrobenzamide (PubChem CID 39752666) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-ethoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]-3-nitrobenzamide.
| Compound Name | 4-ethoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 39752666 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 4-ethoxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)NCC2(N3CCOCC3)CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H29N3O5/c1-2-28-18-7-6-16(14-17(18)23(25)26)19(24)21-15-20(8-4-3-5-9-20)22-10-12-27-13-11-22/h6-7,14H,2-5,8-13,15H2,1H3,(H,21,24) |
| InChIKey | UDFXDIIXXWHZRJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|