C22H20N6O3S — CID 39753313
2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-N-(4-methyl-3-nitrophenyl)benzamide (PubChem CID 39753313) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-N-(4-methyl-3-nitrophenyl)benzamide.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-N-(4-methyl-3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 39753313 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-N-(4-methyl-3-nitrophenyl)benzamide |
| SMILES | Cc1cc(C)n2nc(SCc3ccccc3C(=O)Nc3ccc(C)c([N+](=O)[O-])c3)nc2n1 |
| InChI | InChI=1S/C22H20N6O3S/c1-13-8-9-17(11-19(13)28(30)31)24-20(29)18-7-5-4-6-16(18)12-32-22-25-21-23-14(2)10-15(3)27(21)26-22/h4-11H,12H2,1-3H3,(H,24,29) |
| InChIKey | KMYXNGLOKRHGJT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|