C31H26N4O2 — CID 3975387
2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]-N'-phenylacetohydrazide (PubChem CID 3975387) has the molecular formula C31H26N4O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]-N'-phenylacetohydrazide.
| Compound Name | 2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 3975387 |
| Molecular Formula | C31H26N4O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]-N'-phenylacetohydrazide |
| SMILES | Cc1ccc(-c2[nH]c3ccccc3c2C2c3ccccc3C(=O)N2CC(=O)NNc2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N4O2/c1-20-15-17-21(18-16-20)29-28(25-13-7-8-14-26(25)32-29)30-23-11-5-6-12-24(23)31(37)35(30)19-27(36)34-33-22-9-3-2-4-10-22/h2-18,30,32-33H,19H2,1H3,(H,34,36) |
| InChIKey | JQSQEBMRHPCPBZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|