About (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine
(3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine (PubChem CID 39754147) has the molecular formula C20H43N3O
and a molecular weight of 341.58 g/mol. Its IUPAC name is (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine.
Molecular Properties
| Compound Name | (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine |
| PubChem CID | 39754147 |
| Molecular Formula | C20H43N3O |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.34 |
| IUPAC Name | (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine |
| SMILES | COC(C)(C)CCC[C@H](C)CCNCCN1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C20H43N3O/c1-18(2)23-16-14-22(15-17-23)13-12-21-11-9-19(3)8-7-10-20(4,5)24-6/h18-19,21H,7-17H2,1-6H3/t19-/m0/s1 |
| InChIKey | KHGCOJZEDFXXQP-IBGZPJMESA-N |
| XLogP | 3.22 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine?
The IUPAC name of (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine (CID 39754147) is (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine.
What is the SMILES notation for (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine?
The canonical SMILES for (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine is COC(C)(C)CCC[C@H](C)CCNCCN1CCN(C(C)C)CC1.
What is the InChIKey of (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine?
The InChIKey is KHGCOJZEDFXXQP-IBGZPJMESA-N. The full InChI is InChI=1S/C20H43N3O/c1-18(2)23-16-14-22(15-17-23)13-12-21-11-9-19(3)8-7-10-20(4,5)24-6/h18-19,21H,7-17H2,1-6H3/t19-/m0/s1.
What are the key properties of (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine?
(3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine has a molecular weight of 341.58 g/mol, XLogP of 3.22, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-methoxy-3,7-dimethyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]octan-1-amine is sourced from PubChem (CID 39754147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).