About 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one
3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 39754273) has the molecular formula C10H12N2O3S
and a molecular weight of 240.28 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 39754273 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2ncn1CCOCCO |
| InChI | InChI=1S/C10H12N2O3S/c13-3-5-15-4-2-12-7-11-8-1-6-16-9(8)10(12)14/h1,6-7,13H,2-5H2 |
| InChIKey | CTHDMAKWAPQDGW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one (CID 39754273) is 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one is O=c1c2sccc2ncn1CCOCCO.
What is the InChIKey of 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one?
The InChIKey is CTHDMAKWAPQDGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3S/c13-3-5-15-4-2-12-7-11-8-1-6-16-9(8)10(12)14/h1,6-7,13H,2-5H2.
What are the key properties of 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one?
3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one has a molecular weight of 240.28 g/mol, XLogP of 0.47, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-hydroxyethoxy)ethyl]thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 39754273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).