C18H22N4O2S — CID 39754957
1-[2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetyl]piperidine-4-carboxamide (PubChem CID 39754957) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-[2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39754957 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetyl]piperidine-4-carboxamide |
| SMILES | Cc1ccccc1-n1ccnc1SCC(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C18H22N4O2S/c1-13-4-2-3-5-15(13)22-11-8-20-18(22)25-12-16(23)21-9-6-14(7-10-21)17(19)24/h2-5,8,11,14H,6-7,9-10,12H2,1H3,(H2,19,24) |
| InChIKey | KIHFZYFOTNXEDA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |