C15H19N3O — CID 39755777
3-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-oxadiazole (PubChem CID 39755777) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 39755777 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 3-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-oxadiazole |
| SMILES | c1ccc(Cc2noc(CN3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C15H19N3O/c1-3-7-13(8-4-1)11-14-16-15(19-17-14)12-18-9-5-2-6-10-18/h1,3-4,7-8H,2,5-6,9-12H2 |
| InChIKey | OCVAKOIAFYSAGT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |