C16H13F2N5 — CID 39756638
2-N-benzyl-6-(3,4-difluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 39756638) has the molecular formula C16H13F2N5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-N-benzyl-6-(3,4-difluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-benzyl-6-(3,4-difluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 39756638 |
| Molecular Formula | C16H13F2N5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-N-benzyl-6-(3,4-difluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccccc2)nc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C16H13F2N5/c17-12-7-6-11(8-13(12)18)14-21-15(19)23-16(22-14)20-9-10-4-2-1-3-5-10/h1-8H,9H2,(H3,19,20,21,22,23) |
| InChIKey | SHTQGPWEMPQNSM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |