C24H21N3O3S — CID 39757047
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 39757047) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 39757047 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(COc2ccc(/C=N\NC(=O)CSc3nc4ccccc4o3)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O3S/c1-17-6-8-19(9-7-17)15-29-20-12-10-18(11-13-20)14-25-27-23(28)16-31-24-26-21-4-2-3-5-22(21)30-24/h2-14H,15-16H2,1H3,(H,27,28)/b25-14- |
| InChIKey | KWEZFFDNOHVYKE-QFEZKATASA-N |
| XLogP | 4.96 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|