About [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate
[1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate (PubChem CID 3975717) has the molecular formula C16H14N2O5
and a molecular weight of 314.30 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate |
| PubChem CID | 3975717 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate |
| SMILES | CC(OC(=O)c1cccnc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14N2O5/c1-10(23-16(20)11-3-2-6-17-8-11)15(19)18-12-4-5-13-14(7-12)22-9-21-13/h2-8,10H,9H2,1H3,(H,18,19) |
| InChIKey | XAOWKPFLTRLJGM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate?
The IUPAC name of [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate (CID 3975717) is [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate.
What is the SMILES notation for [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate?
The canonical SMILES for [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate is CC(OC(=O)c1cccnc1)C(=O)Nc1ccc2c(c1)OCO2.
What is the InChIKey of [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate?
The InChIKey is XAOWKPFLTRLJGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O5/c1-10(23-16(20)11-3-2-6-17-8-11)15(19)18-12-4-5-13-14(7-12)22-9-21-13/h2-8,10H,9H2,1H3,(H,18,19).
What are the key properties of [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate?
[1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate has a molecular weight of 314.30 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] pyridine-3-carboxylate is sourced from PubChem (CID 3975717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).