C17H21N5O4S — CID 39757578
butyl 2-[[2-[(4-amino-6-methyl-5-oxo-1,2,4-triazin-3-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 39757578) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is butyl 2-[[2-[(4-amino-6-methyl-5-oxo-1,2,4-triazin-3-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-[(4-amino-6-methyl-5-oxo-1,2,4-triazin-3-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39757578 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | butyl 2-[[2-[(4-amino-6-methyl-5-oxo-1,2,4-triazin-3-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)CSc1nnc(C)c(=O)n1N |
| InChI | InChI=1S/C17H21N5O4S/c1-3-4-9-26-16(25)12-7-5-6-8-13(12)19-14(23)10-27-17-21-20-11(2)15(24)22(17)18/h5-8H,3-4,9-10,18H2,1-2H3,(H,19,23) |
| InChIKey | IYLUXSNQVPKLBX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|