C21H17FN4O4 — CID 3976261
2-cyano-3-[2-(2-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 3976261) has the molecular formula C21H17FN4O4 and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-cyano-3-[2-(2-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[2-(2-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 3976261 |
| Molecular Formula | C21H17FN4O4 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-cyano-3-[2-(2-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | COCCNC(=O)C(C#N)=Cc1c(Oc2ccccc2F)nc2ccccn2c1=O |
| InChI | InChI=1S/C21H17FN4O4/c1-29-11-9-24-19(27)14(13-23)12-15-20(30-17-7-3-2-6-16(17)22)25-18-8-4-5-10-26(18)21(15)28/h2-8,10,12H,9,11H2,1H3,(H,24,27) |
| InChIKey | VGQZXCDYJRBNOS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|