C21H16F3N5O2S — CID 3976434
2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4-[[3-(trifluoromethyl)phenyl]diazenyl]-1H-pyrazol-3-one (PubChem CID 3976434) has the molecular formula C21H16F3N5O2S and a molecular weight of 459.45 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4-[[3-(trifluoromethyl)phenyl]diazenyl]-1H-pyrazol-3-one.
| Compound Name | 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4-[[3-(trifluoromethyl)phenyl]diazenyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3976434 |
| Molecular Formula | C21H16F3N5O2S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4-[[3-(trifluoromethyl)phenyl]diazenyl]-1H-pyrazol-3-one |
| SMILES | COc1ccc(-c2csc(-n3[nH]c(C)c(/N=N/c4cccc(C(F)(F)F)c4)c3=O)n2)cc1 |
| InChI | InChI=1S/C21H16F3N5O2S/c1-12-18(27-26-15-5-3-4-14(10-15)21(22,23)24)19(30)29(28-12)20-25-17(11-32-20)13-6-8-16(31-2)9-7-13/h3-11,28H,1-2H3/b27-26+ |
| InChIKey | VYLOCIKDZYIIDT-CYYJNZCTSA-N |
| XLogP | 6.04 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|