C25H21NO4 — CID 3976635
3-butoxy-N-(9,10-dioxoanthracen-2-yl)benzamide (PubChem CID 3976635) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-butoxy-N-(9,10-dioxoanthracen-2-yl)benzamide.
| Compound Name | 3-butoxy-N-(9,10-dioxoanthracen-2-yl)benzamide |
|---|---|
| PubChem CID | 3976635 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 3-butoxy-N-(9,10-dioxoanthracen-2-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C25H21NO4/c1-2-3-13-30-18-8-6-7-16(14-18)25(29)26-17-11-12-21-22(15-17)24(28)20-10-5-4-9-19(20)23(21)27/h4-12,14-15H,2-3,13H2,1H3,(H,26,29) |
| InChIKey | BHWPEGRREYUTGZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|