C20H20N2O2S — CID 3976740
3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-N,N-dimethylpropanamide (PubChem CID 3976740) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 3976740 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H20N2O2S/c1-22(2)17(23)13-14-25-20-21-18(15-9-5-3-6-10-15)19(24-20)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | OJYODHPZCGOYGF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |