About 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile
2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile (PubChem CID 39768209) has the molecular formula C19H16N2O
and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile |
| PubChem CID | 39768209 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile |
| SMILES | Cc1cc(=O)n(Cc2ccccc2C#N)c2c(C)cccc12 |
| InChI | InChI=1S/C19H16N2O/c1-13-6-5-9-17-14(2)10-18(22)21(19(13)17)12-16-8-4-3-7-15(16)11-20/h3-10H,12H2,1-2H3 |
| InChIKey | JFZYPTMLKQVUKR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile?
The IUPAC name of 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile (CID 39768209) is 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile.
What is the SMILES notation for 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile?
The canonical SMILES for 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile is Cc1cc(=O)n(Cc2ccccc2C#N)c2c(C)cccc12.
What is the InChIKey of 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile?
The InChIKey is JFZYPTMLKQVUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O/c1-13-6-5-9-17-14(2)10-18(22)21(19(13)17)12-16-8-4-3-7-15(16)11-20/h3-10H,12H2,1-2H3.
What are the key properties of 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile?
2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile has a molecular weight of 288.35 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,8-dimethyl-2-oxoquinolin-1-yl)methyl]benzonitrile is sourced from PubChem (CID 39768209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).