C23H22N2O3 — CID 39768357
2-[3-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propyl]isoindole-1,3-dione (PubChem CID 39768357) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[3-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 39768357 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[3-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)c2c(c1)c(C)cc(=O)n2CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22N2O3/c1-14-11-16(3)21-19(12-14)15(2)13-20(26)24(21)9-6-10-25-22(27)17-7-4-5-8-18(17)23(25)28/h4-5,7-8,11-13H,6,9-10H2,1-3H3 |
| InChIKey | LCXXZGDGAPBTQY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|