C23H25NO3 — CID 3977055
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2,4-dimethylbenzoate (PubChem CID 3977055) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2,4-dimethylbenzoate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 3977055 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)C=C2N(C)c3ccccc3C2(C)C)c(C)c1 |
| InChI | InChI=1S/C23H25NO3/c1-15-10-11-18(16(2)12-15)22(26)27-14-17(25)13-21-23(3,4)19-8-6-7-9-20(19)24(21)5/h6-13H,14H2,1-5H3 |
| InChIKey | ZOBRGCKASDNADJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|