About (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine
(3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 39774522) has the molecular formula C17H27NO4S2
and a molecular weight of 373.54 g/mol. Its IUPAC name is (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 39774522 |
| Molecular Formula | C17H27NO4S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CCCCN(C)[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C17H27NO4S2/c1-4-6-11-18(3)16-12-23(19,20)13-17(16)24(21,22)15-9-7-14(5-2)8-10-15/h7-10,16-17H,4-6,11-13H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | HJMFLWZJPOGBPA-IRXDYDNUSA-N |
| XLogP | 1.92 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine (CID 39774522) is (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine is CCCCN(C)[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(CC)cc1.
What is the InChIKey of (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is HJMFLWZJPOGBPA-IRXDYDNUSA-N. The full InChI is InChI=1S/C17H27NO4S2/c1-4-6-11-18(3)16-12-23(19,20)13-17(16)24(21,22)15-9-7-14(5-2)8-10-15/h7-10,16-17H,4-6,11-13H2,1-3H3/t16-,17-/m0/s1.
What are the key properties of (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine?
(3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 373.54 g/mol, XLogP of 1.92, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-N-butyl-4-(4-ethylphenyl)sulfonyl-N-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 39774522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).