C17H25NO4S2 — CID 39774655
(3S,4R)-4-(4-tert-butylphenyl)sulfonyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine (PubChem CID 39774655) has the molecular formula C17H25NO4S2 and a molecular weight of 371.52 g/mol. Its IUPAC name is (3S,4R)-4-(4-tert-butylphenyl)sulfonyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine.
| Compound Name | (3S,4R)-4-(4-tert-butylphenyl)sulfonyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine |
|---|---|
| PubChem CID | 39774655 |
| Molecular Formula | C17H25NO4S2 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (3S,4R)-4-(4-tert-butylphenyl)sulfonyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine |
| SMILES | C=CCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO4S2/c1-5-10-18-15-11-23(19,20)12-16(15)24(21,22)14-8-6-13(7-9-14)17(2,3)4/h5-9,15-16,18H,1,10-12H2,2-4H3/t15-,16-/m0/s1 |
| InChIKey | AOICIRHPZOSZCJ-HOTGVXAUSA-N |
| XLogP | 1.70 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|