C19H32N2O4S2 — CID 39774677
N-[(3S,4R)-4-(4-tert-butylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 39774677) has the molecular formula C19H32N2O4S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is N-[(3S,4R)-4-(4-tert-butylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(3S,4R)-4-(4-tert-butylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 39774677 |
| Molecular Formula | C19H32N2O4S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[(3S,4R)-4-(4-tert-butylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O4S2/c1-19(2,3)15-7-9-16(10-8-15)27(24,25)18-14-26(22,23)13-17(18)20-11-6-12-21(4)5/h7-10,17-18,20H,6,11-14H2,1-5H3/t17-,18-/m0/s1 |
| InChIKey | UKJMLDUADZETOX-ROUUACIJSA-N |
| XLogP | 1.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|