C22H27NO4S2 — CID 39774805
(3S,4R)-N-[(3-methylphenyl)methyl]-1,1-dioxo-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)thiolan-3-amine (PubChem CID 39774805) has the molecular formula C22H27NO4S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is (3S,4R)-N-[(3-methylphenyl)methyl]-1,1-dioxo-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)thiolan-3-amine.
| Compound Name | (3S,4R)-N-[(3-methylphenyl)methyl]-1,1-dioxo-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)thiolan-3-amine |
|---|---|
| PubChem CID | 39774805 |
| Molecular Formula | C22H27NO4S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (3S,4R)-N-[(3-methylphenyl)methyl]-1,1-dioxo-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)thiolan-3-amine |
| SMILES | Cc1cccc(CN[C@H]2CS(=O)(=O)C[C@@H]2S(=O)(=O)c2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C22H27NO4S2/c1-16-5-4-6-17(11-16)13-23-21-14-28(24,25)15-22(21)29(26,27)20-10-9-18-7-2-3-8-19(18)12-20/h4-6,9-12,21-23H,2-3,7-8,13-15H2,1H3/t21-,22-/m0/s1 |
| InChIKey | AGQHBQJYCALLCI-VXKWHMMOSA-N |
| XLogP | 2.60 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |