C17H28N2O5S2 — CID 39775622
N-[(3S,4R)-4-(2-methoxy-4,5-dimethylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 39775622) has the molecular formula C17H28N2O5S2 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-[(3S,4R)-4-(2-methoxy-4,5-dimethylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(3S,4R)-4-(2-methoxy-4,5-dimethylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 39775622 |
| Molecular Formula | C17H28N2O5S2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[(3S,4R)-4-(2-methoxy-4,5-dimethylphenyl)sulfonyl-1,1-dioxothiolan-3-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)[C@H]1CS(=O)(=O)C[C@@H]1NCCN(C)C |
| InChI | InChI=1S/C17H28N2O5S2/c1-12-8-15(24-5)16(9-13(12)2)26(22,23)17-11-25(20,21)10-14(17)18-6-7-19(3)4/h8-9,14,17-18H,6-7,10-11H2,1-5H3/t14-,17-/m0/s1 |
| InChIKey | QZWCPKQWBPYSFY-YOEHRIQHSA-N |
| XLogP | 0.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |