C32H38N2O3S — CID 3978580
N-cyclopropyl-4-hexyl-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]benzamide (PubChem CID 3978580) has the molecular formula C32H38N2O3S and a molecular weight of 530.73 g/mol. Its IUPAC name is N-cyclopropyl-4-hexyl-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]benzamide.
| Compound Name | N-cyclopropyl-4-hexyl-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 3978580 |
| Molecular Formula | C32H38N2O3S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | N-cyclopropyl-4-hexyl-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CC(=O)N2CCc3sccc3C2c2ccc(OC)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C32H38N2O3S/c1-3-4-5-6-7-23-8-10-25(11-9-23)32(36)34(26-14-15-26)22-30(35)33-20-18-29-28(19-21-38-29)31(33)24-12-16-27(37-2)17-13-24/h8-13,16-17,19,21,26,31H,3-7,14-15,18,20,22H2,1-2H3 |
| InChIKey | WLODDVGADCNYPJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|