C25H29N3O4 — CID 3978767
N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 3978767) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 3978767 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc2cc(C3(C)NC(=O)N(CC(=O)NCCC4=CCCCC4)C3=O)ccc2c1 |
| InChI | InChI=1S/C25H29N3O4/c1-25(20-10-8-19-15-21(32-2)11-9-18(19)14-20)23(30)28(24(31)27-25)16-22(29)26-13-12-17-6-4-3-5-7-17/h6,8-11,14-15H,3-5,7,12-13,16H2,1-2H3,(H,26,29)(H,27,31) |
| InChIKey | CLYUTYMWLFSQEP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|