About [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 3978857) has the molecular formula C13H15N3O7S
and a molecular weight of 357.34 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate |
| PubChem CID | 3978857 |
| Molecular Formula | C13H15N3O7S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(=O)NC2CCS(=O)(=O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O7S/c14-10-2-1-8(5-11(10)16(19)20)13(18)23-6-12(17)15-9-3-4-24(21,22)7-9/h1-2,5,9H,3-4,6-7,14H2,(H,15,17) |
| InChIKey | PIAXJFQBSMIWLR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate (CID 3978857) is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate is Nc1ccc(C(=O)OCC(=O)NC2CCS(=O)(=O)C2)cc1[N+](=O)[O-].
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate?
The InChIKey is PIAXJFQBSMIWLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O7S/c14-10-2-1-8(5-11(10)16(19)20)13(18)23-6-12(17)15-9-3-4-24(21,22)7-9/h1-2,5,9H,3-4,6-7,14H2,(H,15,17).
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate?
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate has a molecular weight of 357.34 g/mol, XLogP of -0.36, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-amino-3-nitrobenzoate is sourced from PubChem (CID 3978857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).