About diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate
diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate (PubChem CID 3978955) has the molecular formula C15H16N2O4S
and a molecular weight of 320.37 g/mol. Its IUPAC name is diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate |
| PubChem CID | 3978955 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(=S)n(-c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C15H16N2O4S/c1-3-20-13(18)11-12(14(19)21-4-2)17(15(22)16-11)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H,16,22) |
| InChIKey | PJLJARJJENHAGL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate?
The IUPAC name of diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate (CID 3978955) is diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate.
What is the SMILES notation for diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate?
The canonical SMILES for diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate is CCOC(=O)c1[nH]c(=S)n(-c2ccccc2)c1C(=O)OCC.
What is the InChIKey of diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate?
The InChIKey is PJLJARJJENHAGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O4S/c1-3-20-13(18)11-12(14(19)21-4-2)17(15(22)16-11)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H,16,22).
What are the key properties of diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate?
diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate has a molecular weight of 320.37 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3-phenyl-2-sulfanylidene-1H-imidazole-4,5-dicarboxylate is sourced from PubChem (CID 3978955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).