About 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one
3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one (PubChem CID 3979089) has the molecular formula C25H31N3O3
and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one |
| PubChem CID | 3979089 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one |
| SMILES | CC(C)CN1C(=O)c2ccccc2C1Nc1ccc(C(=O)N2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-16(2)13-28-23(21-7-5-6-8-22(21)25(28)30)26-20-11-9-19(10-12-20)24(29)27-14-17(3)31-18(4)15-27/h5-12,16-18,23,26H,13-15H2,1-4H3 |
| InChIKey | BSEDQPKDDSDVRR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one?
The IUPAC name of 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one (CID 3979089) is 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one.
What is the SMILES notation for 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one?
The canonical SMILES for 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one is CC(C)CN1C(=O)c2ccccc2C1Nc1ccc(C(=O)N2CC(C)OC(C)C2)cc1.
What is the InChIKey of 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one?
The InChIKey is BSEDQPKDDSDVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31N3O3/c1-16(2)13-28-23(21-7-5-6-8-22(21)25(28)30)26-20-11-9-19(10-12-20)24(29)27-14-17(3)31-18(4)15-27/h5-12,16-18,23,26H,13-15H2,1-4H3.
What are the key properties of 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one?
3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one has a molecular weight of 421.54 g/mol, XLogP of 4.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]-2-(2-methylpropyl)-3H-isoindol-1-one is sourced from PubChem (CID 3979089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).