About (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate
(4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate (PubChem CID 39794571) has the molecular formula C19H23NO4S2
and a molecular weight of 393.53 g/mol. Its IUPAC name is (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate.
Molecular Properties
| Compound Name | (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate |
| PubChem CID | 39794571 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)Oc2ccc(C3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C19H23NO4S2/c1-14(21)20-13-18-11-12-19(25-18)26(22,23)24-17-9-7-16(8-10-17)15-5-3-2-4-6-15/h7-12,15H,2-6,13H2,1H3,(H,20,21) |
| InChIKey | MCXKOUZENKAFJM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate?
The IUPAC name of (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate (CID 39794571) is (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate.
What is the SMILES notation for (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate?
The canonical SMILES for (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate is CC(=O)NCc1ccc(S(=O)(=O)Oc2ccc(C3CCCCC3)cc2)s1.
What is the InChIKey of (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate?
The InChIKey is MCXKOUZENKAFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4S2/c1-14(21)20-13-18-11-12-19(25-18)26(22,23)24-17-9-7-16(8-10-17)15-5-3-2-4-6-15/h7-12,15H,2-6,13H2,1H3,(H,20,21).
What are the key properties of (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate?
(4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate has a molecular weight of 393.53 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclohexylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate is sourced from PubChem (CID 39794571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).