About 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide
2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 3979665) has the molecular formula C16H20N4O4
and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide |
| PubChem CID | 3979665 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)Nc2ccc(N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C16H20N4O4/c1-18-11-15(22)20(16(18)23)10-14(21)17-12-2-4-13(5-3-12)19-6-8-24-9-7-19/h2-5H,6-11H2,1H3,(H,17,21) |
| InChIKey | JUBBZPPNCQHHIK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide?
The IUPAC name of 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide (CID 3979665) is 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide.
What is the SMILES notation for 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide?
The canonical SMILES for 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide is CN1CC(=O)N(CC(=O)Nc2ccc(N3CCOCC3)cc2)C1=O.
What is the InChIKey of 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide?
The InChIKey is JUBBZPPNCQHHIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O4/c1-18-11-15(22)20(16(18)23)10-14(21)17-12-2-4-13(5-3-12)19-6-8-24-9-7-19/h2-5H,6-11H2,1H3,(H,17,21).
What are the key properties of 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide?
2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide has a molecular weight of 332.36 g/mol, XLogP of 0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide is sourced from PubChem (CID 3979665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).