About 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide
4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide (PubChem CID 39796767) has the molecular formula C14H13N3O3S2
and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide |
| PubChem CID | 39796767 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCn2cnc3ccsc3c2=O)cc1 |
| InChI | InChI=1S/C14H13N3O3S2/c15-22(19,20)11-3-1-10(2-4-11)5-7-17-9-16-12-6-8-21-13(12)14(17)18/h1-4,6,8-9H,5,7H2,(H2,15,19,20) |
| InChIKey | TZNSYWKLBHBILR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide?
The IUPAC name of 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide (CID 39796767) is 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide?
The canonical SMILES for 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide is NS(=O)(=O)c1ccc(CCn2cnc3ccsc3c2=O)cc1.
What is the InChIKey of 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide?
The InChIKey is TZNSYWKLBHBILR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3S2/c15-22(19,20)11-3-1-10(2-4-11)5-7-17-9-16-12-6-8-21-13(12)14(17)18/h1-4,6,8-9H,5,7H2,(H2,15,19,20).
What are the key properties of 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide?
4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide has a molecular weight of 335.41 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide is sourced from PubChem (CID 39796767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).