C14H13N3O3S2 — CID 39796767
4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide (PubChem CID 39796767) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39796767 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-[2-(4-oxothieno[3,2-d]pyrimidin-3-yl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCn2cnc3ccsc3c2=O)cc1 |
| InChI | InChI=1S/C14H13N3O3S2/c15-22(19,20)11-3-1-10(2-4-11)5-7-17-9-16-12-6-8-21-13(12)14(17)18/h1-4,6,8-9H,5,7H2,(H2,15,19,20) |
| InChIKey | TZNSYWKLBHBILR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |