About 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline
8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline (PubChem CID 39796801) has the molecular formula C14H12N4O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline.
Molecular Properties
| Compound Name | 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline |
| PubChem CID | 39796801 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline |
| SMILES | COc1nc(OC)nc(-c2cccc3cccnc23)n1 |
| InChI | InChI=1S/C14H12N4O2/c1-19-13-16-12(17-14(18-13)20-2)10-7-3-5-9-6-4-8-15-11(9)10/h3-8H,1-2H3 |
| InChIKey | ODHPJEPTJATUJB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline?
The IUPAC name of 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline (CID 39796801) is 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline.
What is the SMILES notation for 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline?
The canonical SMILES for 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline is COc1nc(OC)nc(-c2cccc3cccnc23)n1.
What is the InChIKey of 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline?
The InChIKey is ODHPJEPTJATUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2/c1-19-13-16-12(17-14(18-13)20-2)10-7-3-5-9-6-4-8-15-11(9)10/h3-8H,1-2H3.
What are the key properties of 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline?
8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline has a molecular weight of 268.28 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4,6-dimethoxy-1,3,5-triazin-2-yl)quinoline is sourced from PubChem (CID 39796801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).