C25H38N6O12 — CID 3979792
ditert-butyl 2-[4-amino-6-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-1,3,5-triazin-2-yl]-2-nitropropanedioate (PubChem CID 3979792) has the molecular formula C25H38N6O12 and a molecular weight of 614.61 g/mol. Its IUPAC name is ditert-butyl 2-[4-amino-6-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-1,3,5-triazin-2-yl]-2-nitropropanedioate.
| Compound Name | ditert-butyl 2-[4-amino-6-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-1,3,5-triazin-2-yl]-2-nitropropanedioate |
|---|---|
| PubChem CID | 3979792 |
| Molecular Formula | C25H38N6O12 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | ditert-butyl 2-[4-amino-6-[1,3-bis[(2-methylpropan-2-yl)oxy]-2-nitro-1,3-dioxopropan-2-yl]-1,3,5-triazin-2-yl]-2-nitropropanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)(c1nc(N)nc(C(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)[N+](=O)[O-])n1)[N+](=O)[O-] |
| InChI | InChI=1S/C25H38N6O12/c1-20(2,3)40-15(32)24(30(36)37,16(33)41-21(4,5)6)13-27-14(29-19(26)28-13)25(31(38)39,17(34)42-22(7,8)9)18(35)43-23(10,11)12/h1-12H3,(H2,26,27,28,29) |
| InChIKey | WCDZBVLKEAHTLC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 256.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|