C23H26N4O7 — CID 3980078
[1-[2-(dimethylazaniumyl)ethyl]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(5-methoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methanolate (PubChem CID 3980078) has the molecular formula C23H26N4O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is [1-[2-(dimethylazaniumyl)ethyl]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(5-methoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methanolate.
| Compound Name | [1-[2-(dimethylazaniumyl)ethyl]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(5-methoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methanolate |
|---|---|
| PubChem CID | 3980078 |
| Molecular Formula | C23H26N4O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [1-[2-(dimethylazaniumyl)ethyl]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-(5-methoxycarbonyl-2,4-dimethyl-1H-pyrrol-3-yl)methanolate |
| SMILES | COC(=O)c1[nH]c(C)c(C([O-])=C2C(=O)C(=O)N(CC[NH+](C)C)C2c2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C23H26N4O7/c1-12-16(13(2)24-18(12)23(31)34-5)20(28)17-19(14-6-8-15(9-7-14)27(32)33)26(11-10-25(3)4)22(30)21(17)29/h6-9,19,24,28H,10-11H2,1-5H3 |
| InChIKey | ZMXGVFFHFBSXIM-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|