About N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine
N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine (PubChem CID 3980214) has the molecular formula C17H18N6O3
and a molecular weight of 354.37 g/mol. Its IUPAC name is N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine.
Molecular Properties
| Compound Name | N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine |
| PubChem CID | 3980214 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine |
| SMILES | COc1cc(OC)c(OC)cc1C=Nn1nnnc1Nc1ccccc1 |
| InChI | InChI=1S/C17H18N6O3/c1-24-14-10-16(26-3)15(25-2)9-12(14)11-18-23-17(20-21-22-23)19-13-7-5-4-6-8-13/h4-11H,1-3H3,(H,19,20,22) |
| InChIKey | RGHFIZDFKWCHKL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine?
The IUPAC name of N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine (CID 3980214) is N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine.
What is the SMILES notation for N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine?
The canonical SMILES for N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine is COc1cc(OC)c(OC)cc1C=Nn1nnnc1Nc1ccccc1.
What is the InChIKey of N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine?
The InChIKey is RGHFIZDFKWCHKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N6O3/c1-24-14-10-16(26-3)15(25-2)9-12(14)11-18-23-17(20-21-22-23)19-13-7-5-4-6-8-13/h4-11H,1-3H3,(H,19,20,22).
What are the key properties of N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine?
N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine has a molecular weight of 354.37 g/mol, XLogP of 2.32, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1-[(2,4,5-trimethoxyphenyl)methylideneamino]tetrazol-5-amine is sourced from PubChem (CID 3980214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).