C15H11Cl2N3O4S — CID 3980395
1-(3,5-dichlorophenyl)-3-[(4-hydroxy-5-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyrrolidine-2,5-dione (PubChem CID 3980395) has the molecular formula C15H11Cl2N3O4S and a molecular weight of 400.24 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[(4-hydroxy-5-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[(4-hydroxy-5-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3980395 |
| Molecular Formula | C15H11Cl2N3O4S |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[(4-hydroxy-5-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyrrolidine-2,5-dione |
| SMILES | Cc1c(O)nc(SC2CC(=O)N(c3cc(Cl)cc(Cl)c3)C2=O)[nH]c1=O |
| InChI | InChI=1S/C15H11Cl2N3O4S/c1-6-12(22)18-15(19-13(6)23)25-10-5-11(21)20(14(10)24)9-3-7(16)2-8(17)4-9/h2-4,10H,5H2,1H3,(H2,18,19,22,23) |
| InChIKey | KCGMDBWYBHBFKX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|