C18H17BrN2O2S2 — CID 3980404
2-[2-(3-bromophenoxy)ethylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3980404) has the molecular formula C18H17BrN2O2S2 and a molecular weight of 437.38 g/mol. Its IUPAC name is 2-[2-(3-bromophenoxy)ethylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(3-bromophenoxy)ethylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3980404 |
| Molecular Formula | C18H17BrN2O2S2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | 2-[2-(3-bromophenoxy)ethylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(SCCOc2cccc(Br)c2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H17BrN2O2S2/c19-11-4-3-5-12(10-11)23-8-9-24-18-20-16(22)15-13-6-1-2-7-14(13)25-17(15)21-18/h3-5,10H,1-2,6-9H2,(H,20,21,22) |
| InChIKey | FGKBDTYJLPSNIV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|