C20H16F3N5O2S2 — CID 39805195
2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]acetamide (PubChem CID 39805195) has the molecular formula C20H16F3N5O2S2 and a molecular weight of 479.51 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | 2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 39805195 |
| Molecular Formula | C20H16F3N5O2S2 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)Nc2nc3ccc(OCC(F)(F)F)cc3s2)cc1 |
| InChI | InChI=1S/C20H16F3N5O2S2/c1-12-2-4-13(5-3-12)28-11-24-27-19(28)31-9-17(29)26-18-25-15-7-6-14(8-16(15)32-18)30-10-20(21,22)23/h2-8,11H,9-10H2,1H3,(H,25,26,29) |
| InChIKey | JEWVHWJBORQQRL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |