C22H28ClN3O2 — CID 39815050
(2R)-2-(3-chlorophenoxy)-N-[(E)-[4-(dipropylamino)phenyl]methylideneamino]propanamide (PubChem CID 39815050) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[(E)-[4-(dipropylamino)phenyl]methylideneamino]propanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[(E)-[4-(dipropylamino)phenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 39815050 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[(E)-[4-(dipropylamino)phenyl]methylideneamino]propanamide |
| SMILES | CCCN(CCC)c1ccc(/C=N/NC(=O)[C@@H](C)Oc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-4-13-26(14-5-2)20-11-9-18(10-12-20)16-24-25-22(27)17(3)28-21-8-6-7-19(23)15-21/h6-12,15-17H,4-5,13-14H2,1-3H3,(H,25,27)/b24-16+/t17-/m1/s1 |
| InChIKey | KNZRINVRXBEXAH-MXJLDLDKSA-N |
| XLogP | 4.88 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|