C20H14N4OS — CID 398162
2-Amino-6-(benzylthio)-4-(4-hydroxyphenyl)pyridine-3,5-dicarbonitrile (PubChem CID 398162) has the molecular formula C20H14N4OS and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-amino-6-benzylsulfanyl-4-(4-hydroxyphenyl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-Amino-6-(benzylthio)-4-(4-hydroxyphenyl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 398162 |
| Molecular Formula | C20H14N4OS |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-amino-6-benzylsulfanyl-4-(4-hydroxyphenyl)pyridine-3,5-dicarbonitrile |
| SMILES | C1=CC=C(C=C1)CSC2=C(C(=C(C(=N2)N)C#N)C3=CC=C(C=C3)O)C#N |
| InChI | InChI=1S/C20H14N4OS/c21-10-16-18(14-6-8-15(25)9-7-14)17(11-22)20(24-19(16)23)26-12-13-4-2-1-3-5-13/h1-9,25H,12H2,(H2,23,24) |
| InChIKey | IFPNWUPLRFRCRO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | 553 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |