About 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone
2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone (PubChem CID 3981667) has the molecular formula C18H15BrCl2N3O+
and a molecular weight of 440.15 g/mol. Its IUPAC name is 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone.
Molecular Properties
| Compound Name | 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone |
| PubChem CID | 3981667 |
| Molecular Formula | C18H15BrCl2N3O+ |
| Molecular Weight | 440.15 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone |
| SMILES | Cn1c(-c2ccc(Cl)c(Cl)c2)c[n+](CC(=O)c2ccc(Br)cc2)c1N |
| InChI | InChI=1S/C18H14BrCl2N3O/c1-23-16(12-4-7-14(20)15(21)8-12)9-24(18(23)22)10-17(25)11-2-5-13(19)6-3-11/h2-9,22H,10H2,1H3/p+1 |
| InChIKey | DEHDQMOQBSXOGR-UHFFFAOYSA-O |
| XLogP | 4.51 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.15 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone?
The IUPAC name of 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone (CID 3981667) is 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone.
What is the SMILES notation for 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone?
The canonical SMILES for 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone is Cn1c(-c2ccc(Cl)c(Cl)c2)c[n+](CC(=O)c2ccc(Br)cc2)c1N.
What is the InChIKey of 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone?
The InChIKey is DEHDQMOQBSXOGR-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H14BrCl2N3O/c1-23-16(12-4-7-14(20)15(21)8-12)9-24(18(23)22)10-17(25)11-2-5-13(19)6-3-11/h2-9,22H,10H2,1H3/p+1.
What are the key properties of 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone?
2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone has a molecular weight of 440.15 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-amino-4-(3,4-dichlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone is sourced from PubChem (CID 3981667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).