C25H20N4O — CID 3981697
2-amino-4-(3-phenoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 3981697) has the molecular formula C25H20N4O and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-amino-4-(3-phenoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | 2-amino-4-(3-phenoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 3981697 |
| Molecular Formula | C25H20N4O |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-amino-4-(3-phenoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2cccc(Oc3ccccc3)c2)C2CCCC=C12 |
| InChI | InChI=1S/C25H20N4O/c26-14-22-20-11-4-5-12-21(20)23(25(15-27,16-28)24(22)29)17-7-6-10-19(13-17)30-18-8-2-1-3-9-18/h1-3,6-11,13,21,23H,4-5,12,29H2 |
| InChIKey | GWWULIWUWIAJLT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|