About (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide
(2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide (PubChem CID 39818323) has the molecular formula C16H20N2OS
and a molecular weight of 288.42 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide |
| PubChem CID | 39818323 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide |
| SMILES | Cc1cc(CN[C@@H](Cc2ccccc2)C(N)=O)c(C)s1 |
| InChI | InChI=1S/C16H20N2OS/c1-11-8-14(12(2)20-11)10-18-15(16(17)19)9-13-6-4-3-5-7-13/h3-8,15,18H,9-10H2,1-2H3,(H2,17,19)/t15-/m0/s1 |
| InChIKey | OQXBHKNLXQYFIG-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide?
The IUPAC name of (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide (CID 39818323) is (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide.
What is the SMILES notation for (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide?
The canonical SMILES for (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide is Cc1cc(CN[C@@H](Cc2ccccc2)C(N)=O)c(C)s1.
What is the InChIKey of (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide?
The InChIKey is OQXBHKNLXQYFIG-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H20N2OS/c1-11-8-14(12(2)20-11)10-18-15(16(17)19)9-13-6-4-3-5-7-13/h3-8,15,18H,9-10H2,1-2H3,(H2,17,19)/t15-/m0/s1.
What are the key properties of (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide?
(2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide has a molecular weight of 288.42 g/mol, XLogP of 2.55, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2,5-dimethylthiophen-3-yl)methylamino]-3-phenylpropanamide is sourced from PubChem (CID 39818323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).