C10H12FN5O — CID 39818400
2-[[5-fluoro-2-(1-methylpyrazol-4-yl)pyrimidin-4-yl]amino]ethanol (PubChem CID 39818400) has the molecular formula C10H12FN5O and a molecular weight of 237.24 g/mol. Its IUPAC name is 2-[[5-fluoro-2-(1-methylpyrazol-4-yl)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[5-fluoro-2-(1-methylpyrazol-4-yl)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 39818400 |
| Molecular Formula | C10H12FN5O |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[[5-fluoro-2-(1-methylpyrazol-4-yl)pyrimidin-4-yl]amino]ethanol |
| SMILES | Cn1cc(-c2ncc(F)c(NCCO)n2)cn1 |
| InChI | InChI=1S/C10H12FN5O/c1-16-6-7(4-14-16)9-13-5-8(11)10(15-9)12-2-3-17/h4-6,17H,2-3H2,1H3,(H,12,13,15) |
| InChIKey | AZEMCUAGZSNUNC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |