C17H21N3O3S — CID 3981890
4-(3,4,5-trimethoxyphenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione (PubChem CID 3981890) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione.
| Compound Name | 4-(3,4,5-trimethoxyphenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione |
|---|---|
| PubChem CID | 3981890 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione |
| SMILES | COc1cc(-c2[nH]c(=S)nc3c2CCCCN3)cc(OC)c1OC |
| InChI | InChI=1S/C17H21N3O3S/c1-21-12-8-10(9-13(22-2)15(12)23-3)14-11-6-4-5-7-18-16(11)20-17(24)19-14/h8-9H,4-7H2,1-3H3,(H2,18,19,20,24) |
| InChIKey | HYLROVUVMLVKAR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|