C22H19N3O4 — CID 3981923
ethyl 2-[3-(2,4-dihydroxyphenyl)-4-quinolin-2-ylpyrazol-1-yl]acetate (PubChem CID 3981923) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is ethyl 2-[3-(2,4-dihydroxyphenyl)-4-quinolin-2-ylpyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[3-(2,4-dihydroxyphenyl)-4-quinolin-2-ylpyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 3981923 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl 2-[3-(2,4-dihydroxyphenyl)-4-quinolin-2-ylpyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(-c2ccc3ccccc3n2)c(-c2ccc(O)cc2O)n1 |
| InChI | InChI=1S/C22H19N3O4/c1-2-29-21(28)13-25-12-17(19-10-7-14-5-3-4-6-18(14)23-19)22(24-25)16-9-8-15(26)11-20(16)27/h3-12,26-27H,2,13H2,1H3 |
| InChIKey | BJZHJINQCIHNTG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |